CAS 112375-05-0

2-BENZYL-2-AZABICYCLO[2.2.1]HEPT-5-ENE

Description:

2-Benzyl-2-azabicyclo[2.2.1]hept-5-ene is a bicyclic compound characterized by its unique structure, which includes a bicyclic framework and a benzyl substituent. This compound features a nitrogen atom incorporated into the bicyclic system, contributing to its classification as an azabicyclic compound. The bicyclic structure consists of two fused rings, which can influence its reactivity and stability. The presence of the benzyl group enhances its lipophilicity, potentially affecting its solubility in organic solvents. Additionally, the compound may exhibit interesting pharmacological properties due to the nitrogen atom's ability to participate in hydrogen bonding and its influence on electronic distribution. Its specific stereochemistry and functional groups can also play a significant role in its chemical behavior and interactions with biological systems. Overall, 2-benzyl-2-azabicyclo[2.2.1]hept-5-ene is a compound of interest in medicinal chemistry and organic synthesis, with potential applications in drug development and material science.

Formula: C₁₃H₁₅N

InChI: InChI=1/C13H15N/c1-2-4-11(5-3-1)9-14-10-12-6-7-13(14)8-12/h1-7,12-13H,8-10H2

InChI key: LXICLGVNNWLLTE-UHFFFAOYSA-N

SMILES: c1ccc(cc1)CN1CC2C=CC1C2

Synonyms:

• 2-Aza-2-Benzylbicyclo(2.2.1)Hept-5-Ene

2-Benzyl-2-azabicyclo[2.2.1]hept-5-ene

CAS: 112375-05-0

Formula: C₁₃H₁₅N

Purity: 90%

Color and Shape: Liquid

Molecular weight: 185.2649

Ref: IN-DA007TI5

2-Benzyl-2-azabicyclo[2.2.1]hept-5-ene

CAS: 112375-05-0

2-Benzyl-2-azabicyclo[2.2.1]hept-5-ene

Formula: C₁₃H₁₅N

Purity: ≥95%

Molecular weight: 185.2649

Ref: 54-OR27483

2-Benzyl-2-azabicyclo[2.2.1]hept-5-ene

CAS: 112375-05-0

Purity: 90.9

Molecular weight: 185.2700043

Ref: 10-F790558

2-Benzyl-2-azabicyclo[2.2.1]hept-5-ene

CAS: 112375-05-0

2-Benzyl-2-azabicyclo[2.2.1]hept-5-ene is a reactive molecule that belongs to the class of carbocyclic nucleosides. It reacts with a variety of functional groups, including amide groups and iminium groups, which makes it a useful monomer for peptidomimetic synthesis, as well as copolymerization with other monomers. This compound yields high molecular weight polymers with amide and iminium functionalities in good yield, making it an attractive polymer candidate for drug delivery and biomedical applications.

Formula: C₁₃H₁₅N

Purity: Min. 95%

Molecular weight: 185.27 g/mol

Ref: 3D-MEA37505