CymitQuimica logo

CAS 1124369-40-9

:

S-Pyrrolidine-3-carboxylic acid HCl

Description:
S-Pyrrolidine-3-carboxylic acid HCl, identified by its CAS number 1124369-40-9, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group at the 3-position of the pyrrolidine ring, contributing to its acidic properties. The presence of hydrochloride (HCl) indicates that the compound is in its salt form, which enhances its solubility in water and may influence its stability and bioavailability. S-Pyrrolidine-3-carboxylic acid HCl is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications in drug development and as a building block in organic synthesis. Its stereochemistry, particularly the "S" designation, suggests a specific spatial arrangement of atoms, which can significantly affect its biological activity and interaction with other molecules. Overall, this compound exemplifies the diverse functionalities that can arise from simple cyclic structures in organic chemistry.
Formula:C5H10ClNO2
InChI:InChI=1S/C5H9NO2.ClH/c7-5(8)4-1-2-6-3-4;/h4,6H,1-3H2,(H,7,8);1H/t4-;/m0./s1
InChI key:OYCLYMMIZJWYJG-WCCKRBBISA-N
SMILES:C1CNC[C@H]1C(=O)O.Cl
Synonyms:
  • (S)-Pyrrolidine-3-carboxylic acid hydrochloride
Found 4 products.