CAS 1124381-43-6

Formula: C16H13F3N6O

InChI: InChI=1S/C16H13F3N6O/c17-16(18,19)10-6-12(21-11-3-4-11)25-13(7-10)22-15(24-25)23-14(26)9-2-1-5-20-8-9/h1-2,5-8,11,21H,3-4H2,(H,23,24,26)

InChI key: XUKGFHHTSUKORV-UHFFFAOYSA-N

SMILES: C1CC1NC2=CC(=CC3=NC(=NN23)NC(=O)C4=CN=CC=C4)C(F)(F)F

MSC 2032964A

CAS: 1124381-43-6

Ref: IN-DA0096S2

MSC 2032964A

CAS: 1124381-43-6

MSC 2032964A

Formula: C₁₆H₁₃F₃N₆O

Purity: ≥98%

Molecular weight: 362.31

Ref: 54-BUP07286

MSC 2032964A

CAS: 1124381-43-6

MSC 2032964A: Potent, selective ASK1 inhibitor, IC50=93 nM, oral, brain-permeable, curbs neuroinflammation, blocks LPS-induced ASK1/p38 activation.

Formula: C₁₆H₁₃F₃N₆O

Purity: 99.76%

Color and Shape: Solid

Molecular weight: 362.31

Ref: TM-T33514

MSC 2032964A

CAS: 1124381-43-6

MSC 2032964A is a synthetic small molecule compound, which is derived from a complex multi-step chemical synthesis process. It functions as an inhibitor of specific enzymatic pathways within cellular processes, displaying selectivity based on molecular interactions at the binding site.

Formula: C₁₆H₁₃F₃N₆O

Purity: Min. 95%

Molecular weight: 362.31 g/mol

Ref: 3D-ZUB38143