CymitQuimica logo

CAS 1124382-72-4

:

2-Amino-8-bromo[1,2,4]triazolo[1,5-a]pyridine

Description:
2-Amino-8-bromo[1,2,4]triazolo[1,5-a]pyridine is a heterocyclic compound characterized by the presence of both triazole and pyridine rings in its structure. This compound features an amino group and a bromine atom, which contribute to its reactivity and potential biological activity. The triazole ring is known for its stability and ability to participate in various chemical reactions, while the pyridine moiety often imparts basicity and aromatic properties. The presence of the bromine atom can enhance the compound's lipophilicity and may influence its interaction with biological targets. This substance is of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its unique structure allows for various synthetic modifications, which can lead to derivatives with enhanced activity or selectivity. Additionally, the compound's solubility, melting point, and other physical properties would depend on the specific conditions under which it is synthesized and purified. Overall, 2-Amino-8-bromo[1,2,4]triazolo[1,5-a]pyridine represents a valuable scaffold for further research in chemical and pharmaceutical applications.
Formula:C6H5BrN4
InChI:InChI=1S/C6H5BrN4/c7-4-2-1-3-11-5(4)9-6(8)10-11/h1-3H,(H2,8,10)
InChI key:SUFKKFLJJMKVJJ-UHFFFAOYSA-N
SMILES:C1=CN2C(=NC(=N2)N)C(=C1)Br
Synonyms:
  • 8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine
  • 8-Bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine
Found 5 products.