CymitQuimica logo

CAS 112440-46-7

:

CIS-1,2-DICYANO-1,2-BIS(2,4,5-TRIMETHYL-3-THIENYL)ETHENE

Description:
Cis-1,2-dicyano-1,2-bis(2,4,5-trimethyl-3-thienyl)ethene, identified by its CAS number 112440-46-7, is an organic compound characterized by its unique structure featuring two thienyl groups and cyano substituents. This compound exhibits a cis configuration, which influences its physical and chemical properties, including its optical characteristics. It is typically a solid at room temperature and may display vibrant colors due to the presence of conjugated double bonds, which can lead to interesting electronic and optical behaviors. The thienyl groups contribute to its stability and solubility in organic solvents, while the cyano groups enhance its reactivity, making it useful in various chemical applications, including organic synthesis and materials science. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for studies in photochemistry and potential applications in organic electronics or as a dye. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C18H18N2S2
InChI:InChI=1/C18H18N2S2/c1-9-11(3)21-13(5)17(9)15(7-19)16(8-20)18-10(2)12(4)22-14(18)6/h1-6H3/b16-15-
InChI key:AYNDKKQQUZPETC-NXVVXOECSA-N
SMILES:Cc1c(C)sc(C)c1/C(=C(/C#N)\c1c(C)c(C)sc1C)/C#N
Synonyms:
  • 1,2-Bis(2,4,5-Trimethyl-3-Thienyl)-Cis-1,2-Dicyanoethene
  • Cis-1,2-Dicyano-1,2-Bis
Found 5 products.