CymitQuimica logo

CAS 112440-47-8

:

Bistrimethylthienylmaleicanhydride; 95%

Description:
Bistrimethylthienylmaleicanhydride, with the CAS number 112440-47-8, is a chemical compound characterized by its unique structure that includes both thienyl and maleic anhydride functionalities. This compound typically appears as a solid and is known for its reactivity, particularly in polymer chemistry and organic synthesis. The presence of the maleic anhydride moiety allows for the formation of adducts with nucleophiles, making it useful in various chemical reactions, including Diels-Alder reactions and as a building block in the synthesis of more complex molecules. The trimethylthienyl groups contribute to its electronic properties and solubility characteristics, which can influence its behavior in different solvents. As a substance with a purity of 95%, it is often utilized in research and industrial applications where high-quality reagents are required. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C18H18O3S2
InChI:InChI=1/C18H18O3S2/c1-7-9(3)22-11(5)13(7)15-16(18(20)21-17(15)19)14-8(2)10(4)23-12(14)6/h1-6H3
InChI key:ANYDHJQJXVIYHM-UHFFFAOYSA-N
SMILES:Cc1c(C)sc(C)c1C1=C(c2c(C)c(C)sc2C)C(=O)OC1=O
Synonyms:
  • 2,3-Bis(2,4,5-trimethyl-3-thienyl)maleic anhydride
  • 3,4-Bis(2,4,5-Trimethylthiophen-3-Yl)Furan-2,5-Dione
Found 4 products.