CymitQuimica logo

CAS 112459-79-7

:

2-Oxazolidinone, 3-(1-oxobutyl)-4-(phenylmethyl)-, (S)-

Description:
2-Oxazolidinone, 3-(1-oxobutyl)-4-(phenylmethyl)-, (S)-, with CAS number 112459-79-7, is a chiral compound characterized by its oxazolidinone ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This substance features a butyl side chain with a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a phenylmethyl group enhances its aromatic characteristics, which can influence its solubility and interaction with biological systems. As a chiral molecule, it exists in two enantiomeric forms, with the (S)- configuration being of particular interest in pharmaceutical applications due to its potential biological activity. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, making it relevant in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions, and it is typically handled with standard safety precautions in laboratory settings.
Formula:C14H17NO3
InChI:InChI=1S/C14H17NO3/c1-2-6-13(16)15-12(10-18-14(15)17)9-11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3/t12-/m0/s1
InChI key:HEJIYTVOUUVHRY-LBPRGKRZSA-N
SMILES:CCCC(=O)N1[C@H](COC1=O)CC2=CC=CC=C2
Found 2 products.