CymitQuimica logo

CAS 1125-11-7

:

2,5,5-trimethylcyclohexane-1,3-dione

Description:
2,5,5-Trimethylcyclohexane-1,3-dione, with the CAS number 1125-11-7, is an organic compound characterized by its cyclic structure and the presence of two ketone functional groups. This compound features a cyclohexane ring that is substituted with three methyl groups and two carbonyl groups located at the 1 and 3 positions. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure allows for various chemical reactions, including condensation and oxidation, making it useful in the synthesis of more complex organic molecules. Additionally, the compound's physical properties, such as boiling point and solubility, can vary based on the specific conditions and the presence of other solvents. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C9H14O2
InChI:InChI=1/C9H14O2/c1-6-7(10)4-9(2,3)5-8(6)11/h6H,4-5H2,1-3H3
SMILES:CC1C(=O)CC(C)(C)CC1=O
Synonyms:
  • 1,3-Cyclohexanedione, 2,5,5-trimethyl-
  • 2,5,5-Trimethyl-1,3-cyclohexanedione
Found 1 products.