CAS 1125-52-6
:Benzene, 1-bromo-2,3,4,5-tetrachloro-
Description:
Benzene, 1-bromo-2,3,4,5-tetrachloro- is an organic compound characterized by a benzene ring substituted with one bromine atom and four chlorine atoms at specific positions. This compound is part of the halogenated aromatic hydrocarbons, which are known for their potential environmental and health impacts. The presence of multiple chlorine atoms contributes to its high stability and lipophilicity, making it less soluble in water but more soluble in organic solvents. It is typically a colorless to yellowish liquid with a distinctive odor. Due to the halogen substituents, this compound may exhibit significant biological activity, including potential toxicity and carcinogenicity. Its chemical structure can lead to various reactions, including nucleophilic substitution and electrophilic aromatic substitution. Handling this compound requires caution due to its hazardous nature, and it is subject to regulations concerning its use and disposal. Overall, Benzene, 1-bromo-2,3,4,5-tetrachloro- is an important compound in the study of environmental chemistry and toxicology.
Formula:C6HBrCl4
InChI:InChI=1S/C6HBrCl4/c7-2-1-3(8)5(10)6(11)4(2)9/h1H
InChI key:NEPMWYGBQGFJHN-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C(=C1Br)Cl)Cl)Cl)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Bromo-2,3,4,5-tetrachlorobenzene
CAS:Controlled ProductApplications 1-Bromo-2,3,4,5-tetrachlorobenzene is an intermediate in the synthesis of 3,4,2',3',4',5'-Hexachlorobiphenyl (H290958), is a toxic organic pollutant.
References Noren, K., Meironyte, D.: Chemosphere, 40, 1111 (2000); Shoeib, M., Harner, T.: Environ. Sci. Technol., 36, 4142 (2002);Formula:C6HBrCl4Color and Shape:NeatMolecular weight:294.79
