CymitQuimica logo

CAS 1125-62-8

:

Quinazoline, 4-chloro-5,6,7,8-tetrahydro-

Description:
Quinazoline, 4-chloro-5,6,7,8-tetrahydro- is a heterocyclic compound characterized by a fused bicyclic structure that includes a quinazoline moiety. This compound features a chlorine atom at the 4-position of the quinazoline ring, contributing to its reactivity and potential biological activity. The tetrahydro configuration indicates that the compound contains four hydrogen-saturated carbon atoms, which enhances its stability and solubility in various solvents. Quinazoline derivatives are of significant interest in medicinal chemistry due to their diverse pharmacological properties, including antitumor, antimicrobial, and anti-inflammatory activities. The presence of the chlorine substituent can influence the compound's lipophilicity and interaction with biological targets. Additionally, the compound's molecular structure allows for various synthetic modifications, making it a valuable scaffold in drug discovery. Overall, 4-chloro-5,6,7,8-tetrahydroquinazoline represents a versatile chemical entity with potential applications in pharmaceuticals and research.
Formula:C8H9ClN2
InChI:InChI=1S/C8H9ClN2/c9-8-6-3-1-2-4-7(6)10-5-11-8/h5H,1-4H2
InChI key:InChIKey=AHCZEYDUHAFFKD-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=N1)CCCC2
Found 5 products.