CymitQuimica logo

CAS 112517-23-4

:

4,5-DIBROMO-1-TRIPHENYLMETHYL-1H-IMIDAZOLE

Description:
4,5-Dibromo-1-trityl-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of bromine substituents at the 4 and 5 positions of the imidazole ring enhances its reactivity and influences its electronic properties. The triphenylmethyl group, or trityl group, attached to the nitrogen atom contributes to the compound's stability and solubility in organic solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of various pharmaceuticals or agrochemicals. Its unique structure allows for potential applications in materials science, particularly in the development of organic electronic devices. The compound's physical properties, such as melting point and solubility, can vary based on the specific conditions and purity. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 4,5-dibromo-1-trityl-1H-imidazole is notable for its structural complexity and potential utility in various chemical applications.
Formula:C22H16Br2N2
InChI:InChI=1/C22H16Br2N2/c23-20-21(24)26(16-25-20)22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H
InChI key:ZHVSCWZZBQRLCU-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)n1cnc(c1Br)Br
Synonyms:
  • 4,5-Dibromo-1-Trityl-1H-Imidazole
  • 4,5-Dibromo-1-triphenylmethyl-1H-imidazole 98%
  • 4,5-Dibromo-1-Trityl-Imidazole
Found 2 products.