CymitQuimica logo

CAS 1125410-07-2

:

5-Chloro-2-hydroxy-4-iodopyridine

Description:
5-Chloro-2-hydroxy-4-iodopyridine is a heterocyclic organic compound characterized by its pyridine ring, which contains both chlorine and iodine substituents, as well as a hydroxyl group. The presence of the hydroxyl group (–OH) contributes to its potential as a polar compound, influencing its solubility in various solvents. The chlorine atom, located at the 5-position, and the iodine atom at the 4-position of the pyridine ring can affect the compound's reactivity and stability, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, which is often explored in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be determined through experimental methods, providing further insights into its behavior and applications in chemical synthesis and research.
Formula:C5H3ClINO
InChI:InChI=1S/C5H3ClINO/c6-3-2-8-5(9)1-4(3)7/h1-2H,(H,8,9)
InChI key:XGUZXMHAZKSDMD-UHFFFAOYSA-N
SMILES:C1=C(C(=CNC1=O)Cl)I
Found 3 products.