CymitQuimica logo

CAS 112558-72-2

:

Benzyl 4-(2-Aminoacetamido)butanoate Hydrochloride

Description:
Benzyl 4-(2-Aminoacetamido)butanoate hydrochloride is a chemical compound characterized by its amide functional group and ester linkage. It is a white to off-white crystalline solid, soluble in water and organic solvents, which makes it suitable for various applications in pharmaceuticals and biochemistry. The presence of the benzyl group contributes to its hydrophobic characteristics, while the amino and carboxyl functional groups enhance its reactivity and potential for forming hydrogen bonds. This compound is often studied for its role in drug development, particularly in the synthesis of peptide-based therapeutics. Its hydrochloride salt form indicates that it is a stable, ionized version of the base compound, which can improve its solubility and bioavailability. As with many amides, it may exhibit moderate stability under physiological conditions, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C13H18N2O3·ClH
InChI:InChI=1S/C13H18N2O3.ClH/c14-9-12(16)15-8-4-7-13(17)18-10-11-5-2-1-3-6-11;/h1-3,5-6H,4,7-10,14H2,(H,15,16);1H
InChI key:JECYRSNZIXFTGT-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC(=O)CCCNC(=O)CN.Cl
Synonyms:
  • Benzyl 4-(2-Aminoacetamido)butanoate Hydrochloride
Found 3 products.