CymitQuimica logo

CAS 112575-11-8

:

(6-BROMO-PYRIDIN-2-YL)-ACETONITRILE

Description:
(6-Bromo-pyridin-2-yl)acetonitrile, with the CAS number 112575-11-8, is an organic compound characterized by its pyridine ring structure substituted with a bromine atom at the 6-position and an acetonitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents, making it useful in various chemical reactions and applications. The presence of the bromine atom enhances its reactivity, allowing it to participate in nucleophilic substitution reactions, which are valuable in synthetic organic chemistry. Additionally, the acetonitrile group contributes to its polarity and potential as a solvent or reagent in chemical processes. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, owing to its functional groups that can undergo further transformations. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C7H5BrN2
InChI:InChI=1/C7H5BrN2/c8-7-3-1-2-6(10-7)4-5-9/h1-3H,4H2
InChI key:WUYNZPVTHRDYDT-UHFFFAOYSA-N
SMILES:c1cc(CC#N)nc(c1)Br
Synonyms:
  • (6-Bromopyridin-2-yl)acetonitrile
  • 2-Pyridineacetonitrile, 6-Bromo-
Found 4 products.