CymitQuimica logo

CAS 1126-23-4

:

8-methyl-5,9-dihydro-6H-purine-6-thione

Description:
8-Methyl-5,9-dihydro-6H-purine-6-thione, with the CAS number 1126-23-4, is a purine derivative characterized by its unique structural features, including a methyl group at the 8-position and a thione functional group at the 6-position of the purine ring. This compound typically exhibits properties associated with purines, such as being a heterocyclic aromatic compound. It is generally soluble in polar solvents, which is common for many purine derivatives, and may exhibit biological activity, potentially influencing nucleic acid metabolism or serving as a precursor in various biochemical pathways. The presence of the thione group can impart specific reactivity, making it of interest in medicinal chemistry and biochemistry. Additionally, its molecular structure allows for potential interactions with biological macromolecules, which could be explored for therapeutic applications. Overall, 8-methyl-5,9-dihydro-6H-purine-6-thione represents a compound of interest in both synthetic and biological chemistry contexts.
Formula:C6H6N4S
InChI:InChI=1/C6H6N4S/c1-3-9-4-5(10-3)7-2-8-6(4)11/h2,4H,1H3,(H,7,8,9,10,11)
SMILES:CC1=NC2C(=N1)N=CN=C2S
Found 1 products.