CAS 1126032-65-2

Isomogroside V

Description:

Isomogroside V is a triterpenoid saponin compound primarily derived from the plant species *S. grosvenorii*, commonly known as monk fruit. This compound is notable for its sweetening properties, which are significantly more potent than sucrose, making it a popular natural sweetener in food and beverage applications. Isomogroside V exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anti-diabetic effects, contributing to its appeal in health-related products. The compound is characterized by its complex molecular structure, which includes multiple sugar moieties attached to a triterpenoid backbone. Its solubility in water and stability under various pH conditions make it suitable for diverse formulations. Additionally, Isomogroside V is generally recognized as safe (GRAS) for consumption, further enhancing its utility in the food industry. Research continues to explore its pharmacological potential and mechanisms of action, highlighting its significance in both nutrition and therapeutic applications.

Formula: C₆₀H₁₀₂O₂₉

InChI: InChI=1S/C60H102O29/c1-23(9-13-35(57(4,5)79)87-55-50(89-54-47(77)42(72)38(68)29(20-63)83-54)43(73)39(69)31(85-55)22-80-51-45(75)40(70)36(66)27(18-61)81-51)24-15-16-58(6)32-12-10-25-26(60(32,8)33(65)17-59(24,58)7)11-14-34(56(25,2)3)86-52-48(78)44(74)49(30(21-64)84-52)88-53-46(76)41(71)37(67)28(19-62)82-53/h10,23-24,26-55,61-79H,9,11-22H2,1-8H3/t23-,24-,26-,27-,28-,29-,30-,31-,32+,33-,34+,35-,36-,37-,38-,39-,40+,41+,42+,43+,44-,45-,46-,47-,48-,49-,50-,51-,52+,53+,54+,55+,58+,59-,60+/m1/s1

InChI key: SQKPHECGTGXVQW-MRLZYGMXSA-N

SMILES: C[C@H](CC[C@H](C(C)(C)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)[C@H]4CC[C@@]5([C@@]4(C[C@H]([C@@]6([C@H]5CC=C7[C@H]6CC[C@@H](C7(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)C)O)C)C

Isomogroside V

CAS: 1126032-65-2

Isomogroside V

Formula: C₆₀H₁₀₂O₂₉

Purity: 99.5%

Molecular weight: 1287.43

Ref: 54-BUP20127

Isomogroside V

CAS: 1126032-65-2

Formula: C₆₀H₁₀₂O₂₉

Molecular weight: 1287.45

Ref: 7W-GY9334

Isomogroside V

CAS: 1126032-65-2

Isomogroside V (Iso-mogroside V) is a sweetener extracted from Siraitia grosvenorii that is approximately 500 times sweeter than 0.5% (w/v) sucrose.

Formula: C₆₀H₁₀₂O₂₉

Purity: 97.07% - 99.83%

Color and Shape: White Solid

Molecular weight: 1287.4344

Ref: TM-TN1770

Isomogroside V

CAS: 1126032-65-2

Formula: C₆₀H₁₀₂O₂₉

Molecular weight: 1287.4345

Ref: IN-DA008YTZ

Isomogroside V (Standard)

CAS: 1126032-65-2

Isomogroside V (Standard) is a reference standard for research and analysis in studies involving Isomogroside V. Isomogroside V (Iso-mogroside V) is a sweetener extracted from Siraitia grosvenorii that is approximately 500 times sweeter than 0.5% (w/v) sucrose.

Formula: C₆₀H₁₀₂O₂₉

Color and Shape: Solid

Molecular weight: 1287.4344

Ref: TM-TMSM-3021

Isomogroside V

CAS: 1126032-65-2

Formula: C₆₀H₁₀₂O₂₉

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 1287.45

Ref: BP-BP3449

Isomogroside V

CAS: 1126032-65-2

Natural glycoside

Formula: C₆₀H₁₀₂O₂₉

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 1287.43

Ref: 5G-84226

Isomogroside V

CAS: 1126032-65-2

Isomogroside V is a natural non-caloric sweetener, which is extracted from the fruit of Siraitia grosvenorii, commonly known as monk fruit or luo han guo. This compound belongs to the family of mogrosides, which are glycosylated triterpenoids. The mode of action of Isomogroside V is primarily through its interaction with the sweet taste receptors on the human tongue, specifically the TAS1R2/TAS1R3 receptor complex, where it induces a perception of sweetness with a potency significantly higher than sucrose.

Formula: C₆₀H₁₀₂O₂₉

Purity: Min. 95%

Molecular weight: 1,287.45 g/mol

Ref: 3D-BVB03265

Isomogroside V

CAS: 1126032-65-2

Formula: C₆₀H₁₀₂O₂₉

Molecular weight: 1287.4

Ref: BE-RMT22208