CymitQuimica logo

CAS 1126367-34-7

:

1-Bromo-2-chloro-4-methyl-5-nitrobenzene

Description:
1-Bromo-2-chloro-4-methyl-5-nitrobenzene is an aromatic halogenated compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, along with a methyl group and a nitro group. This compound typically exhibits a pale yellow to brownish color and is likely to be a solid at room temperature. Its molecular structure includes a nitro group, which is a strong electron-withdrawing group, influencing the compound's reactivity and polarity. The presence of halogens (bromine and chlorine) suggests that it may participate in nucleophilic substitution reactions, while the nitro group can enhance electrophilic aromatic substitution. The compound's solubility is generally limited in water but may be more soluble in organic solvents. Due to the presence of halogens and a nitro group, it may also exhibit toxicity and environmental persistence, necessitating careful handling and disposal. Overall, 1-Bromo-2-chloro-4-methyl-5-nitrobenzene is of interest in various chemical applications, including synthesis and research in organic chemistry.
Formula:C7H5BrClNO2
InChI:InChI=1S/C7H5BrClNO2/c1-4-2-6(9)5(8)3-7(4)10(11)12/h2-3H,1H3
InChI key:AYBMAXWOTGLSBQ-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1[N+](=O)[O-])Br)Cl
Synonyms:
  • 1-Bromo-2-chloro-4-methyl-5-nitro-benzene
Found 5 products.