CymitQuimica logo

CAS 1126385-20-3

:

(2-broMo-4,5-diMethylphenyl)Methanol

Description:
(2-Bromo-4,5-dimethylphenyl)methanol is an organic compound characterized by its aromatic structure, which includes a bromine substituent and two methyl groups on the phenyl ring. The presence of the hydroxymethyl (-CH2OH) group indicates that it is an alcohol, which contributes to its potential reactivity and solubility in polar solvents. The bromine atom enhances the compound's electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The methyl groups provide steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, (2-bromo-4,5-dimethylphenyl)methanol is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C9H11BrO
InChI:InChI=1S/C9H11BrO/c1-6-3-8(5-11)9(10)4-7(6)2/h3-4,11H,5H2,1-2H3
InChI key:BBOZOFOSGSSLQJ-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1C)Br)CO
Synonyms:
  • (2-broMo-4,5-diMethylphenyl)Methanol
  • Benzenemethanol, 2-bromo-4,5-dimethyl-
  • Pinaverium Bromide Impurity 3
Found 4 products.