CymitQuimica logo

CAS 112646-70-5

:

Estrane, 1,6-hexanediamine deriv.

Description:
Estrane, 1,6-hexanediamine deriv. is a chemical compound characterized by its structure, which includes a steroid backbone derived from estrane, combined with a hexanediamine moiety. This compound typically exhibits properties associated with both steroidal and amine functionalities, which may influence its solubility, reactivity, and biological activity. The presence of the hexanediamine component suggests potential for forming hydrogen bonds and participating in various chemical reactions, such as amine-based coupling or polymerization. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular interactions could be significant in biological systems, potentially affecting receptor binding or enzyme activity. As with many chemical substances, safety data and handling precautions are essential, given the potential for toxicity or reactivity. Overall, Estrane, 1,6-hexanediamine deriv. represents a unique intersection of steroid chemistry and amine functionality, warranting further investigation for its applications in various fields.
Formula:C25H40N2O
InChI:InChI=1S/C25H40N2O/c1-25-14-13-21-20-10-8-19(28-2)17-18(20)7-9-22(21)23(25)11-12-24(25)27-16-6-4-3-5-15-26/h8,10,17,21-24,27H,3-7,9,11-16,26H2,1-2H3/t21-,22-,23+,24+,25+/m1/s1
InChI key:IVUWYMCIIBQTQB-VAFBSOEGSA-N
SMILES:C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2NCCCCCCN)CCC4=C3C=CC(=C4)OC
Synonyms:
  • N1- ((8R, 9S, 13S, 14S, 17S) -3-methoxy-13-methyl7,8,9,11,12,13,14,15,16,17 decahydro-6H-cyclopentadieno [a] phenanthrene-17-yl) hexane-1,6-diamine
  • Estrane, 1,6-hexanediamine deriv.
  • 1,6-Hexanediamine, N-[(17β)-3-methoxyestra-1,3,5(10)-trien-17-yl]- (9CI)
  • N1-((8R,9S,13S,14S,17S)-3-methoxy-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-17-yl)hexane-1,6-diamine
Found 2 products.