CymitQuimica logo

CAS 112648-68-7

:

U-73122

Description:
U-73122 is a chemical compound known for its role as a selective inhibitor of phospholipase C (PLC), an enzyme involved in various cellular signaling pathways. It is often utilized in biochemical research to study signal transduction mechanisms, particularly those related to G-protein-coupled receptors. U-73122 is characterized by its ability to disrupt the hydrolysis of phosphatidylinositol 4,5-bisphosphate, leading to a decrease in inositol trisphosphate and diacylglycerol levels, which are crucial for calcium signaling and protein kinase activation. The compound is typically used in laboratory settings and is not intended for therapeutic use in humans. Its chemical structure includes specific functional groups that contribute to its inhibitory activity, making it a valuable tool for researchers investigating the roles of PLC in various physiological and pathological processes. As with many research chemicals, proper handling and safety precautions are essential due to its potential biological effects.
Formula:C29H40N2O3
InChI:InChI=1S/C29H40N2O3/c1-29-16-15-23-22-10-8-21(34-2)19-20(22)7-9-24(23)25(29)11-12-26(29)30-17-5-3-4-6-18-31-27(32)13-14-28(31)33/h8,10,13-14,19,23-26,30H,3-7,9,11-12,15-18H2,1-2H3/t23-,24-,25+,26+,29+/m1/s1
InChI key:InChIKey=LUFAORPFSVMJIW-ZRJUGLEFSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=CC(OC)=CC4)(CC1)[H])[H])(CC[C@@H]2NCCCCCCN5C(=O)C=CC5=O)[H]
Synonyms:
  • 1-(6-{[(17beta)-3-methoxyestra-1,3,5(10)-trien-17-yl]amino}hexyl)-1H-pyrrole-2,5-dione
  • 1-[6-[[(17β)-3-Methoxyestra-1,3,5(10)-trien-17-yl]amino]hexyl]-1H-pyrrole-2,5-dione
  • 1H-Pyrrole-2,5-dione, 1-[6-[[(17β)-3-methoxyestra-1,3,5(10)-trien-17-yl]amino]hexyl]-
  • Estrane, 1H-pyrrole-2,5-dione deriv.
  • U73122
Found 6 products.