CymitQuimica logo

CAS 1126522-69-7

:

9-Phenyl-9H-carbazole-3-boronic acid pinacol ester

Description:
9-Phenyl-9H-carbazole-3-boronic acid pinacol ester is an organoboron compound characterized by its boronic acid functionality, which is typically used in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. This compound features a carbazole core, which is a fused bicyclic structure known for its stability and electronic properties, making it useful in organic electronics and photonic applications. The presence of the phenyl group enhances its electronic characteristics, potentially improving its light absorption and emission properties. The pinacol ester moiety provides stability to the boronic acid group, making it less reactive under certain conditions while still allowing for participation in cross-coupling reactions. This compound is likely to exhibit solubility in organic solvents, and its reactivity can be influenced by the electronic nature of the substituents on the carbazole and phenyl rings. Overall, 9-Phenyl-9H-carbazole-3-boronic acid pinacol ester is a versatile compound with applications in materials science, organic synthesis, and potentially in the development of optoelectronic devices.
Formula:C24H24BNO2
InChI:InChI=1S/C24H24BNO2/c1-23(2)24(3,4)28-25(27-23)17-14-15-22-20(16-17)19-12-8-9-13-21(19)26(22)18-10-6-5-7-11-18/h5-16H,1-4H3
InChI key:UBASCOPZFCGGAV-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(C4=CC=CC=C43)C5=CC=CC=C5
Synonyms:
  • 9-Phenyl-3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-9H-Carbazole
Found 5 products.