CAS 112677-67-5
:Benzenamine, 3-(1H-imidazol-1-yl)-
Description:
Benzenamine, 3-(1H-imidazol-1-yl)-, also known as 3-(1H-imidazol-1-yl)aniline, is an organic compound characterized by the presence of both an aniline group and an imidazole ring. This compound features a benzene ring substituted with an amino group (–NH2) and an imidazole moiety, which contributes to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The imidazole ring can participate in hydrogen bonding and may influence the compound's reactivity and interaction with biological targets. This substance is of interest in medicinal chemistry and materials science, as it may serve as a building block for the synthesis of more complex molecules or as a ligand in coordination chemistry. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a given reaction or application.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c10-8-2-1-3-9(6-8)12-5-4-11-7-12/h1-7H,10H2
InChI key:JVKJLZRWXBUBFN-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)N2C=CN=C2)N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-(1H-Imidazol-1-yl)aniline
CAS:3-(1H-Imidazol-1-yl)anilineFormula:C9H9N3Purity:95%Color and Shape:SolidMolecular weight:159.187853-(1H-Imidazol-1-yl)aniline
CAS:Formula:C9H9N3Purity:98%Color and Shape:SolidMolecular weight:159.18793-(1H-Imidazol-1-yl)aniline
CAS:3-(1H-Imidazol-1-yl)anilineFormula:C9H9N3Purity:98%Molecular weight:159.193-(1H-Imidazol-1-yl)aniline
CAS:Formula:C9H9N3Purity:96%Color and Shape:SolidMolecular weight:159.1923-Imidazol-1-yl-phenylamine
CAS:3-Imidazol-1-yl-phenylamine is an organic compound that contains both aromatic and heterocyclic moieties. 3-Imidazol-1-yl-phenylamine has high thermal stability and selectivity, as well as affinity for ionic membranes. It is used in the chemical industry to transport cations such as K+, Na+, Li+, NH4+ and Ca2+. The imidazolium functional group in 3-imidazol-1-yl phenylamine contributes to its membrane affinity and ion transport properties. This compound also has a low toxicity and is not flammable or corrosive at room temperature.
Formula:C9H9N3Purity:Min. 95%Molecular weight:159.19 g/mol




