CymitQuimica logo

CAS 1126779-33-6

:

Benzonitrile, 4-broMo-2-chloro-5-fluoro-

Description:
Benzonitrile, 4-bromo-2-chloro-5-fluoro- is an organic compound characterized by its aromatic structure, which includes a nitrile functional group (-C≡N) attached to a benzene ring that is further substituted with bromine, chlorine, and fluorine atoms. This compound typically exhibits a colorless to pale yellow appearance and is known for its volatility and solubility in organic solvents. The presence of halogen substituents (bromine, chlorine, and fluorine) can significantly influence its chemical reactivity and physical properties, such as boiling and melting points. The nitrile group contributes to its polar nature, which can enhance its interactions in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit specific biological activities, making it of interest in pharmaceutical and agrochemical research. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H2BrClFN
InChI:InChI=1S/C7H2BrClFN/c8-5-2-6(9)4(3-11)1-7(5)10/h1-2H
InChI key:QRVZOLCBNJYMJK-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1F)Br)Cl)C#N
Synonyms:
  • Benzonitrile, 4-broMo-2-chloro-5-fluoro-
Found 3 products.