CymitQuimica logo

CAS 1126795-00-3

:

3-oxa-9-azabicyclo[3.3.1]nonan-7-one hydrochloride

Description:
3-Oxa-9-azabicyclo[3.3.1]nonan-7-one hydrochloride is a bicyclic compound characterized by its unique structural framework, which includes a nitrogen atom and an oxygen atom incorporated into a bicyclic system. This compound features a bicyclo[3.3.1] structure, indicating that it consists of two bridged cycloalkane rings, with a ketone functional group at the 7-position and a hydrochloride salt form, which enhances its solubility in polar solvents. The presence of the nitrogen atom contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for its possible biological activities. The hydrochloride form typically indicates that the compound is a salt, which can influence its stability, solubility, and bioavailability. As with many bicyclic compounds, it may exhibit interesting stereochemical properties and reactivity patterns, making it a subject of study in organic synthesis and drug development. Overall, this compound's unique structure and functional groups suggest potential applications in various fields, including pharmaceuticals and materials science.
Formula:C7H12ClNO2
InChI:InChI=1S/C7H11NO2.ClH/c9-7-1-5-3-10-4-6(2-7)8-5;/h5-6,8H,1-4H2;1H
InChI key:WEAFOEKQEGQXCG-UHFFFAOYSA-N
SMILES:C1C2COCC(N2)CC1=O.Cl
Found 3 products.