CAS 1127-01-1
:Cyclohexanecarboxylic acid, 1-hydroxy-, ethyl ester
Description:
Cyclohexanecarboxylic acid, 1-hydroxy-, ethyl ester, also known by its CAS number 1127-01-1, is an organic compound characterized by its ester functional group derived from cyclohexanecarboxylic acid. This compound features a cyclohexane ring with a carboxylic acid group and a hydroxyl group at the first position, along with an ethyl ester group. It is typically a colorless to pale yellow liquid with a pleasant odor, indicating its potential use in flavoring or fragrance applications. The presence of both the hydroxyl and ester groups contributes to its solubility in organic solvents and moderate solubility in water. Cyclohexanecarboxylic acid, 1-hydroxy-, ethyl ester exhibits properties typical of esters, such as being less dense than water and having a relatively low boiling point. It may also participate in various chemical reactions, including esterification and hydrolysis. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c1-2-12-8(10)9(11)6-4-3-5-7-9/h11H,2-7H2,1H3
InChI key:InChIKey=LVGBBZRMRVLEFH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(O)CCCCC1
Synonyms:- 1-Hydroxycyclohexanecarboxylic acid ethyl ester
- Cyclohexanecarboxylic acid, 1-hydroxy-, ethyl ester
- Ethyl 1-hydroxycyclohexane-1-carboxylate
- Ethyl 1-hydroxycyclohexanecarboxylate
- NSC 7384
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 1-hydroxycyclohexanecarboxylate
CAS:Ethyl 1-hydroxycyclohexanecarboxylateFormula:C9H16O3Purity:95%Molecular weight:172.22154Ethyl 1-hydroxycyclohexanecarboxylate
CAS:Formula:C9H16O3Purity:98%Color and Shape:SolidMolecular weight:172.2215Ethyl 1-hydroxycyclohexanecarboxylate
CAS:Formula:C9H16O3Purity:96%Color and Shape:LiquidMolecular weight:172.224Ethyl 1-hydroxycyclohexanecarboxylate
CAS:Ethyl 1-hydroxycyclohexanecarboxylate is an aliphatic, cyclic compound that belongs to the group of superacids. It is a byproduct of the reaction between benzene and ethyl chloroformate. This reaction requires a catalyst, such as potassium tert-butoxide or tetrabutylammonium fluoride. The molecule has a tetrahydrofuran ring with a hydroxy group and can be classified as an aldehyde, which is formed by the removal of two hydrogen atoms from the carbonyl carbon atom. Ethyl 1-hydroxycyclohexanecarboxylate also undergoes a shift in its equilibrium position when it interacts with other compounds, such as elemental analysis or five-membered hydrocarbons.Formula:C9H16O3Purity:Min. 95%Molecular weight:172.22 g/mol




