CymitQuimica logo

CAS 1127-13-5

:

Bicyclo[2.2.2]octane-1-carboxylic acid, 4-hydroxy-

Description:
Bicyclo[2.2.2]octane-1-carboxylic acid, 4-hydroxy- (CAS number 1127-13-5) is a bicyclic organic compound characterized by its unique bicyclo[2.2.2]octane framework, which consists of two fused cyclopropane rings. This compound features a carboxylic acid functional group (-COOH) at the 1-position and a hydroxyl group (-OH) at the 4-position of the bicyclic structure, contributing to its reactivity and potential applications in organic synthesis. The presence of these functional groups enhances its solubility in polar solvents and allows for various chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. Bicyclo[2.2.2]octane derivatives are of interest in medicinal chemistry and materials science due to their unique structural properties and potential biological activities. Additionally, the compound's stereochemistry and conformational flexibility can influence its interactions and reactivity, making it a subject of study in both theoretical and experimental chemistry. Overall, this compound exemplifies the intriguing chemistry associated with bicyclic systems.
Formula:C9H14O3
InChI:InChI=1S/C9H14O3/c10-7(11)8-1-4-9(12,5-2-8)6-3-8/h12H,1-6H2,(H,10,11)
InChI key:LXQJPKMORWPZGM-UHFFFAOYSA-N
SMILES:C1CC2(CCC1(CC2)C(=O)O)O
Found 6 products.