CAS 112747-98-5
:b-D-Glucopyranoside,4-[(2S,3R,4R)-4-[[4-(b-D-glucopyranosyloxy)-3-methoxyphenyl]methyl]tetrahydro-3-(hydroxymethyl)-2-furanyl]-2-methoxyphenyl
Description:
The chemical substance known as b-D-Glucopyranoside, 4-[(2S,3R,4R)-4-[[4-(b-D-glucopyranosyloxy)-3-methoxyphenyl]methyl]tetrahydro-3-(hydroxymethyl)-2-furanyl]-2-methoxyphenyl, with the CAS number 112747-98-5, is a complex glycoside. It features multiple functional groups, including glucopyranoside moieties, which are sugar units that contribute to its solubility and reactivity. The presence of methoxy and hydroxymethyl groups indicates potential for hydrogen bonding and reactivity, influencing its biological activity. This compound is likely to exhibit properties typical of glycosides, such as sweetness and potential bioactivity, which may include antioxidant or anti-inflammatory effects. Its stereochemistry, indicated by the specific configurations at various chiral centers, suggests that it may interact selectively with biological targets. Overall, this compound's structural complexity and functional diversity make it of interest in fields such as medicinal chemistry and natural product research, where it may serve as a lead compound for drug development or as a tool for studying biochemical pathways.
Formula:C32H44O16
InChI:InChI=1S/C32H44O16/c1-42-20-8-14(3-5-18(20)45-31-28(40)26(38)24(36)22(11-34)47-31)7-16-13-44-30(17(16)10-33)15-4-6-19(21(9-15)43-2)46-32-29(41)27(39)25(37)23(12-35)48-32/h3-6,8-9,16-17,22-41H,7,10-13H2,1-2H3/t16-,17-,22+,23+,24+,25+,26-,27-,28+,29+,30+,31+,32+/m0/s1
InChI key:PBLWZMSRSJTRHJ-NCIRKIHRSA-N
SMILES:COC1=C(C=CC(=C1)C[C@H]2CO[C@@H]([C@H]2CO)C3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O
Synonyms:- b-D-Glucopyranoside, 4-[4-[[4-(b-D-glucopyranosyloxy)-3-methoxyphenyl]methyl]tetrahydro-3-(hydroxymethyl)-2-furanyl]-2-methoxyphenyl,[2S-(2a,3b,4b)]-
- 7S,8R,8'R-(-)-Lariciresinol 4,4'-bis-O-b-D-glucopyranoside
- Clemastanin B
- Lariciresinol4,4'-bis-O-b-D-glucopyranoside
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-[(2S,3R,4R)-4-[[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]methyl]tetrahydro-3-(hydroxymethyl)-2-furanyl]-2-methoxyphenyl β-D-glucopyranoside
CAS:4-[(2S,3R,4R)-4-[[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]methyl]tetrahydro-3-(hydroxymethyl)-2-furanyl]-2-methoxyphenyl β-D-glucopyranosideFormula:C32H44O16Purity:98%Molecular weight:684.68Clemastanin B
CAS:Clemastanin B is an antioxidant, anti-inflammatory, and anti-influenza agent that prevents virus replication and attachment.Formula:C32H44O16Purity:98%Color and Shape:SolidMolecular weight:684.68Clemastanin B
CAS:Clemastanin B is a natural product that belongs to the group of antiviral agents. It has been shown to inhibit the replication of avian influenza, syncytial influenza, and herpes simplex virus. Clemastanin B has also been shown to have an inhibitory effect on the growth of human liver cancer cells in vitro. The antiviral activity against these viruses may be due to its ability to inhibit protein synthesis and cell division. Clemastanin B has been used in traditional Chinese medicine preparations for a number of conditions such as infectious diseases and pharmaceutical dosage.br> The LC-MS/MS method was used for identification and quantification of Clemastanin B from samples taken from the stomachs of cows with diarrhea.Formula:C32H44O16Purity:Min. 95%Molecular weight:684.7 g/mol





