CAS 112766-96-8
:ardisiacrispin B
Description:
Ardisiacrispin B is a natural compound classified as a flavonoid, specifically a type of polyphenolic compound. It is derived from various plant sources, particularly those belonging to the genus Ardisia. This compound is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Ardisiacrispin B exhibits a complex molecular structure that contributes to its reactivity and interaction with biological systems. Its chemical properties include solubility in organic solvents and varying stability under different pH conditions. Research into ardisiacrispin B has highlighted its potential therapeutic applications, particularly in traditional medicine, although further studies are necessary to fully elucidate its mechanisms of action and efficacy. As with many natural products, the extraction and purification processes can significantly influence its availability and concentration, making it a subject of interest in both pharmacognosy and medicinal chemistry.
Formula:C53H86O22
InChI:InChI=1/C53H86O22/c1-23-32(58)36(62)39(65)43(69-23)75-42-38(64)34(60)25(19-55)71-46(42)72-26-20-67-45(41(35(26)61)74-44-40(66)37(63)33(59)24(18-54)70-44)73-31-10-11-49(5)27(47(31,2)3)8-12-50(6)28(49)9-13-53-29-16-48(4,21-56)14-15-52(29,22-68-53)30(57)17-51(50,53)7/h21,23-46,54-55,57-66H,8-20,22H2,1-7H3/t23-,24?,25+,26-,27-,28+,29+,30+,31-,32-,33+,34+,35-,36+,37-,38-,39+,40+,41+,42+,43-,44-,45-,46-,48-,49-,50+,51-,52?,53?/m0/s1
InChI key:ZDIHSHLFPFGAGP-LLEYBADXSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@H]3CO[C@H]([C@@H]([C@H]3O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5CC[C@@]6([C@H]7CC[C@@]89[C@@H]1C[C@@](CC[C@]1(CO8)[C@@H](C[C@]9([C@@]7(CC[C@H]6C5(C)C)C)C)O)(C)C=O)C)CO)O)O)O)O)O
Synonyms:- 3beta-O-(alpha-L-Rhamnopyranosyl-(1-2)-O-beta-D-glucopyranosyl-(1-4)-(O-beta-D-glucopyranosyl-(1-2))-alpha-L-arabinopyranosyl)-16alpha-hydroxy-13beta,28-epoxyolean-30-al
- Oleanan-29-al, 3-((O-6-deoxy-alpha-L-mannopyranosyl-(1-2)-O-beta-D-glucopyranosyl-(1-4)-O-(beta-D-glucopyranosyl-(1-2))-alpha-L-arabinopyranosyl)oxy)-13,28-epoxy-16-hydroxy-, (3beta,16alpha,20beta)-
- (3beta,13xi,16alpha,17xi)-16-hydroxy-30-oxo-13,28-epoxyoleanan-3-yl 6-deoxy-alpha-L-mannopyranosyl-(1->2)-beta-D-glucopyranosyl-(1->4)-[(5xi)-beta-D-xylo-hexopyranosyl-(1->2)]-alpha-L-arabinopyranoside
- Ardisiacrispin B
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ardisiacrispin B
CAS:Ardisiacrispin B is a natural triterpenoid saponin, anticancer, apoptosis and ferroptosis, exhibiting inhibitory effects against A549, HL-60, MDA-MB-231.Formula:C53H86O22Purity:98%Color and Shape:White SolidMolecular weight:1075.2367Ardisiacrispin B
CAS:Ardisiacrispin B is a naturally occurring alkaloid, which is isolated from the roots of Ardisia species, a genus of flowering plants found in various tropical regions. It acts as a bioactive compound with complex molecular interactions influencing cellular pathways, particularly those involving apoptosis and anti-proliferative activities. Ardisiacrispin B has demonstrated inhibitory effects on specific cancer cell lines, suggesting its potential role in therapeutic intervention. In addition to anticancer properties, its unique molecular structure offers promising exploration in drug development for a range of other diseases. The compound's efficacy in modulating biological pathways makes it a subject of interest for further pharmacological research, as understanding its precise mechanisms of action could contribute to the advancement of targeted medical therapies.Formula:C53H86O22Purity:Min. 95%Molecular weight:1,075.2 g/mol




