
CAS 112793-01-8
:N6-(2-Deoxy-D-glucos-2-yl)-L-lysine
Description:
N6-(2-Deoxy-D-glucos-2-yl)-L-lysine, with the CAS number 112793-01-8, is a modified amino acid that features a lysine backbone with a 2-deoxy-D-glucose moiety attached at the nitrogen atom of the amino group. This compound is characterized by its structural complexity, combining features of both amino acids and carbohydrates, which may influence its biological activity and interactions. The presence of the deoxy sugar can affect solubility, stability, and reactivity, making it of interest in biochemical and pharmaceutical research. It may play a role in various biological processes, including protein synthesis and cellular signaling. The compound's unique structure allows for potential applications in drug design, particularly in targeting specific biological pathways or enhancing the delivery of therapeutic agents. As with many modified amino acids, its properties can vary significantly based on environmental conditions such as pH and temperature, which can influence its behavior in biological systems.
Formula:C12H24N2O7
InChI:InChI=1S/C12H24N2O7/c13-7(12(20)21)3-1-2-4-14-8(5-15)10(18)11(19)9(17)6-16/h5,7-11,14,16-19H,1-4,6,13H2,(H,20,21)/t7-,8-,9+,10+,11+/m0/s1
InChI key:DNMDGVIVITZJJM-FBDQPXRJSA-N
SMILES:C(CCN[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O)C[C@@H](C(=O)O)N
Synonyms:- L-Lysine, N6-(2-deoxy-D-glucos-2-yl)-
- N6-(2-Deoxy-D-glucos-2-yl)-L-lysine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N6-(2-Deoxy-D-glucos-2-yl)-L-lysine
CAS:N6-(2-Deoxy-D-glucos-2-yl)-L-lysineFormula:C12H24N2O7Color and Shape:SolidMolecular weight:308.32816


