CymitQuimica logo

CAS 1128-47-8

:

6-methyl-1H-indole-2,3-dione

Description:
6-Methyl-1H-indole-2,3-dione, also known as 6-methylindole-2,3-dione, is an organic compound characterized by its indole structure, which features a fused bicyclic system consisting of a benzene ring and a pyrrole ring. This compound contains a methyl group at the 6-position and two carbonyl groups at the 2 and 3 positions, contributing to its diketone nature. It is typically a yellow to orange crystalline solid, exhibiting moderate solubility in organic solvents. The presence of the carbonyl groups makes it reactive, particularly in nucleophilic addition reactions. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activities and applications in the development of pharmaceuticals. Its properties, such as melting point, boiling point, and spectral data, can vary based on purity and environmental conditions. Safety data should be consulted before handling, as it may pose health risks if ingested or inhaled.
Formula:C9H7NO2
InChI:InChI=1/C9H7NO2/c1-5-2-3-6-7(4-5)10-9(12)8(6)11/h2-4H,1H3,(H,10,11,12)
InChI key:VFJUMJDSHGVFAH-UHFFFAOYSA-N
SMILES:Cc1ccc2c(c1)NC(=O)C2=O
Synonyms:
  • 1H-indole-2,3-dione, 6-methyl-
Found 8 products.