CymitQuimica logo

CAS 1128-71-8

:

4-oxazol-5-ylphenol

Description:
4-Oxazol-5-ylphenol, with the CAS number 1128-71-8, is an organic compound characterized by the presence of both an oxazole ring and a phenolic group. The oxazole moiety consists of a five-membered heterocyclic ring containing both nitrogen and oxygen, contributing to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group in the phenol structure, which can engage in hydrogen bonding. 4-Oxazol-5-ylphenol is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. Its reactivity can be influenced by the electron-withdrawing nature of the oxazole ring, which can affect the acidity of the phenolic hydroxyl group. Additionally, this compound may participate in various chemical reactions, such as electrophilic substitutions or coupling reactions, due to the presence of both aromatic and heterocyclic functionalities. Overall, 4-oxazol-5-ylphenol is a versatile compound with applications in pharmaceuticals and materials science.
Formula:C9H7NO2
InChI:InChI=1/C9H7NO2/c11-8-3-1-7(2-4-8)9-5-10-6-12-9/h1-6,11H
InChI key:DKJOJWMIGCSJKJ-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1cnco1)O
Synonyms:
  • 4-(1,3-Oxazol-5-yl)phenol
  • Phenol, 4-(5-oxazolyl)-
Found 4 products.