CymitQuimica logo

CAS 112809-52-6

:

4,4'-(4H-1,2,4-Triazol-4-ylmethylene)bis benzonitrile

Description:
4,4'-(4H-1,2,4-Triazol-4-ylmethylene)bis benzonitrile, with the CAS number 112809-52-6, is a chemical compound characterized by its unique structure that includes a triazole ring and two benzonitrile groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the triazole moiety suggests potential applications as a fungicide or in medicinal chemistry, particularly in the development of antifungal agents. Additionally, the benzonitrile groups may contribute to its electronic properties, influencing its reactivity and interaction with biological targets. The compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature. Overall, 4,4'-(4H-1,2,4-Triazol-4-ylmethylene)bis benzonitrile represents a versatile structure with potential applications in both research and industry.
Formula:C17H11N5
InChI:InChI=1/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-11-20-21-12-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H
InChI key:BCTXUGAAOFIJGX-UHFFFAOYSA-N
SMILES:c1cc(ccc1C#N)C(c1ccc(cc1)C#N)n1cnnc1
Synonyms:
  • 4,4'-(4H-1,2,4-triazol-4-ylmethanediyl)dibenzonitrile
  • 4,4'-(4H-1,2,4-Triazol-4-ylmethylene)dibenzonitrile
  • benzonitrile, 4,4'-(4H-1,2,4-triazol-4-ylmethylene)bis-
  • 4-[(4-Cyanophenyl)-(1,2,4-Triazol-4-Yl)Methyl]Benzonitrile
Found 13 products.