CymitQuimica logo

CAS 11281-65-5

:

2,4,5-Trifluoro-3-Methoxy Benzoic Acid

Description:
2,4,5-Trifluoro-3-Methoxy Benzoic Acid is an aromatic carboxylic acid characterized by the presence of three fluorine atoms and a methoxy group attached to a benzoic acid structure. The trifluoromethyl groups at the 2, 4, and 5 positions significantly influence its chemical properties, enhancing its lipophilicity and potentially altering its reactivity compared to non-fluorinated analogs. The methoxy group at the 3-position contributes to its overall polarity and can affect its solubility in various solvents. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique structure makes it of interest in various fields, including pharmaceuticals and agrochemicals, where fluorinated compounds often exhibit enhanced biological activity. Additionally, the presence of both electron-withdrawing (fluorine) and electron-donating (methoxy) groups can lead to interesting electronic properties, influencing its reactivity in chemical reactions. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.
Formula:C8H5ClF2O
InChI:InChI=1/C8H5ClF2O/c1-4-6(10)3-2-5(7(4)11)8(9)12/h2-3H,1H3
InChI key:YVJHZWWMKFQKDC-UHFFFAOYSA-N
SMILES:Cc1c(ccc(c1F)C(=O)Cl)F
Synonyms:
  • 2,4,5-Trifluoro-3-methoxybenzoic acid
  • 3-Methoxy-2,4,5-Trifluorobenzoic Acid
  • 2,4,5-Trifluoro-3-Methoxybenzoate
  • 2,4-Difluoro-3-Methylbenzoyl Chloride
Found 3 products.