CymitQuimica logo

CAS 112811-63-9

:

3-METHOXY-2,4,5-TRIFLUOROBENZONITRILE

Description:
3-Methoxy-2,4,5-trifluorobenzenonitrile, with the CAS number 112811-63-9, is an organic compound characterized by the presence of a methoxy group and three fluorine atoms attached to a benzene ring, along with a nitrile functional group. This compound typically exhibits a high degree of polarity due to the electronegative fluorine atoms, which can influence its reactivity and solubility in various solvents. The trifluoromethyl groups can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The nitrile group contributes to its potential as a building block in organic synthesis. Additionally, the presence of the methoxy group can affect the compound's hydrogen bonding capabilities and overall reactivity. As with many fluorinated compounds, it may exhibit unique physical properties, such as increased boiling point and altered melting point compared to non-fluorinated analogs. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks.
Formula:C8H4F3NO
InChI:InChI=1/C8H4F3NO/c1-13-8-6(10)4(3-12)2-5(9)7(8)11/h2H,1H3
InChI key:JFKKSZAQWUIHBF-UHFFFAOYSA-N
SMILES:COc1c(c(cc(c1F)F)C#N)F
Synonyms:
  • 2,4,5-Trifluoro-3-methoxybenzonitrile
  • Benzonitrile, 2,4,5-trifluoro-3-methoxy-
  • Ncr Bf Df Ef Co1
Found 4 products.