CymitQuimica logo

CAS 112819-26-8

:

4H-1-Benzothiopyran-4-one, 6-bromo-2,3-dihydro-, 1,1-dioxide

Description:
4H-1-Benzothiopyran-4-one, 6-bromo-2,3-dihydro-, 1,1-dioxide, identified by its CAS number 112819-26-8, is a chemical compound that belongs to the class of benzothiopyran derivatives. This compound features a fused benzene and thiophene ring system, which contributes to its unique chemical properties. The presence of a bromine atom at the 6-position enhances its reactivity and potential applications in organic synthesis. The 1,1-dioxide functional group indicates the presence of sulfone functionality, which can influence the compound's polarity and solubility in various solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The structural characteristics suggest potential applications in fields such as agrochemicals, pharmaceuticals, and materials science. However, specific reactivity, stability, and biological effects would require further investigation through empirical studies and characterization techniques.
Formula:C9H7BrO3S
InChI:InChI=1S/C9H7BrO3S/c10-6-1-2-9-7(5-6)8(11)3-4-14(9,12)13/h1-2,5H,3-4H2
InChI key:ZIDGASJWZBLPDL-UHFFFAOYSA-N
SMILES:C1CS(=O)(=O)C2=C(C1=O)C=C(C=C2)Br
Found 4 products.