CymitQuimica logo

CAS 112822-82-9

:

1-BroMo-2,4,5-trifluoro-3-Methylbenzene

Description:
1-Bromo-2,4,5-trifluoro-3-methylbenzene, with the CAS number 112822-82-9, is an aromatic compound characterized by the presence of a bromine atom and three fluorine atoms attached to a methyl-substituted benzene ring. This compound exhibits a complex structure due to the combination of halogen substituents, which significantly influence its chemical properties, such as reactivity and polarity. The bromine atom typically enhances the electrophilic character of the aromatic ring, making it more susceptible to nucleophilic attack. The trifluoromethyl groups contribute to the compound's overall electronegativity and can affect its solubility in various solvents. Additionally, the presence of multiple fluorine atoms often leads to increased thermal stability and altered physical properties compared to non-fluorinated analogs. This compound may find applications in organic synthesis, pharmaceuticals, or materials science, where halogenated aromatic compounds are of interest due to their unique reactivity and stability profiles. Safety precautions should be observed when handling this substance, as halogenated compounds can pose health and environmental risks.
Formula:C7H4BrF3
InChI:InChI=1S/C7H4BrF3/c1-3-6(10)4(8)2-5(9)7(3)11/h2H,1H3
InChI key:MARJTTMEOKZEQJ-UHFFFAOYSA-N
SMILES:CC1=C(C(=CC(=C1F)Br)F)F
Found 4 products.