CAS 112822-91-0
:1-CYCLOPROPYL-4-OXO-6,7-DIFLUORO-8-METHYL-QUINOLIN
Description:
1-Cyclopropyl-4-oxo-6,7-difluoro-8-methyl-quinoline, identified by its CAS number 112822-91-0, is a synthetic organic compound belonging to the quinoline family. This compound features a quinoline core structure, which is a bicyclic aromatic compound known for its diverse biological activities. The presence of a cyclopropyl group and difluoro substituents at specific positions enhances its chemical reactivity and potential pharmacological properties. The 4-oxo group contributes to its ability to participate in various chemical reactions, while the methyl group at the 8-position may influence its lipophilicity and overall biological activity. Quinoline derivatives are often studied for their antimicrobial, antiviral, and anticancer properties, making this compound of interest in medicinal chemistry. Its unique structural features may also affect its solubility, stability, and interaction with biological targets, which are crucial for its potential applications in drug development. Further studies would be necessary to fully elucidate its properties and potential therapeutic uses.
Formula:C13H11F2NO
InChI:InChI=1S/C13H11F2NO/c1-7-12(15)10(14)6-9-11(17)4-5-16(13(7)9)8-2-3-8/h4-6,8H,2-3H2,1H3
InChI key:DQIOJVYKKSEGOW-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC(=C1F)F)C(=O)C=CN2C3CC3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Cyclopropyl-6,7-difluoro-8-methylquinolin-4(1H)-one
CAS:Formula:C13H11F2NOMolecular weight:235.2293
