CAS 112828-69-0

A3

Description:

The chemical substance known as "A3" with the CAS number 112828-69-0 is identified as a specific compound that may have applications in various fields, including materials science and pharmaceuticals. While detailed characteristics such as its molecular structure, physical properties, and specific uses may not be widely documented, substances with similar identifiers often exhibit unique chemical behaviors, such as reactivity, solubility, and stability under different conditions. Typically, compounds like A3 may be characterized by their molecular weight, functional groups, and potential interactions with other chemicals. Safety data sheets would provide essential information regarding toxicity, handling, and storage requirements. For precise applications and characteristics, consulting specialized databases or scientific literature would be necessary, as they can provide comprehensive insights into the compound's behavior and potential uses in research or industry.

Formula: C₃₀H₅₂O₂₆

InChI: InChI=1S/C30H52O26/c31-1-7(35)25(55-29-22(46)19(43)15(39)10(3-33)52-29)13(37)8(36)5-49-28-24(48)26(56-30-23(47)20(44)16(40)11(4-34)53-30)17(41)12(54-28)6-50-27-21(45)18(42)14(38)9(2-32)51-27/h1,7-30,32-48H,2-6H2/t7-,8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18+,19+,20+,21+,22+,23+,24+,25-,26+,27+,28+,29-,30-/m1/s1

InChI key: YPQGRSSAXDUGEC-LHCUGFEVSA-N

SMILES: C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@@H]([C@H](O2)OC[C@H]([C@H]([C@@H]([C@@H](C=O)O)O[C@@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O)O[C@@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O)O)O

3α,6α-Mannopentaose

CAS: 112828-69-0

3α,6α-Mannopentaose is a biochemical reagent employed in glycobiology research. This field examines the structure, synthesis, biology, and evolution of sugars, encompassing carbohydrate chemistry, glycan formation and degradation enzymology, protein-glycan recognition, and the roles of glycans in biological systems. Glycobiology is closely linked with fundamental research, biomedicine, and biotechnology.

Formula: C₃₀H₅₂O₂₆

Color and Shape: Solid

Molecular weight: 828.72

Ref: TM-TSW-00659

a1-3,a1-3,a1-6-Mannopentaose

CAS: 112828-69-0

Ref: 7W-GC4127

a1-3[a1-6]a1-6[a1-3]Mannopentaose

CAS: 112828-69-0

Found in glycoproteins including ovalbumin and human immunoglobulin M

Formula: C₃₀H₅₂O₂₆

Purity: Min. 95 Area-%

Color and Shape: White Powder

Molecular weight: 828.72 g/mol

Ref: 3D-OM05332