CymitQuimica logo

CAS 112835-62-8

:

N-[(1R,2S)-2-Hydroxy-1,2-diphenylethyl]-glycine ethyl ester

Description:
N-[(1R,2S)-2-Hydroxy-1,2-diphenylethyl]-glycine ethyl ester, with CAS number 112835-62-8, is an organic compound characterized by its structure, which includes a glycine moiety linked to a chiral diphenylethyl group. This compound typically exhibits properties associated with amino acids and esters, such as solubility in polar solvents and potential biological activity due to its amino acid-like structure. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, influencing its solubility and reactivity. The chiral center in the diphenylethyl group suggests that the compound may exhibit stereoisomerism, which can affect its pharmacological properties. As an ethyl ester, it may also undergo hydrolysis to release the corresponding acid, which can be relevant in biological systems. Overall, this compound may have applications in medicinal chemistry, particularly in the design of pharmaceuticals that target specific biological pathways.
Formula:C18H21NO3
InChI:InChI=1S/C18H21NO3/c1-2-22-16(20)13-19-17(14-9-5-3-6-10-14)18(21)15-11-7-4-8-12-15/h3-12,17-19,21H,2,13H2,1H3/t17-,18+/m1/s1
InChI key:LEAUHTMORLZYBA-MSOLQXFVSA-N
SMILES:CCOC(=O)CN[C@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)O
Synonyms:
  • Ethyl 2-((1R,2S)-2-hydroxy-1,2-diphenylethylamino)acetate
Found 2 products.