CAS 112860-04-5
:N-(6-methoxypyridin-3-yl)cyclopropanecarboxamide
Description:
N-(6-methoxypyridin-3-yl)cyclopropanecarboxamide, with the CAS number 112860-04-5, is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a pyridine moiety. The presence of the methoxy group on the pyridine ring enhances its lipophilicity and may influence its biological activity. This compound is typically classified as an amide due to the presence of the carboxamide functional group, which can participate in hydrogen bonding, potentially affecting its solubility and reactivity. The cyclopropane structure contributes to the compound's rigidity, which can be significant in drug design, as it may affect the compound's interaction with biological targets. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Overall, this compound represents a fascinating example of how structural features can influence chemical behavior and potential applications.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c1-14-9-5-4-8(6-11-9)12-10(13)7-2-3-7/h4-7H,2-3H2,1H3,(H,12,13)
Synonyms:- cyclopropanecarboxamide, N-(6-methoxy-3-pyridinyl)-
- N-(6-Methoxy-3-pyridinyl)cyclopropanecarboxamide
- N-(6-Methoxy-3-pyridinyl)cyclopropancarboxamid
- N-(6-Méthoxy-3-pyridinyl)cyclopropanecarboxamide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
cyclopropyl-N-(6-methoxy(3-pyridyl))formamide
CAS:Please enquire for more information about cyclopropyl-N-(6-methoxy(3-pyridyl))formamide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C10H12N2O2Purity:Min. 95%Molecular weight:192.21 g/mol
