CymitQuimica logo

CAS 112887-25-9

:

2-Fluoro-5-sulfamoyl-benzoic acid

Description:
2-Fluoro-5-sulfamoyl-benzoic acid is an aromatic sulfonamide compound characterized by the presence of a fluoro group and a sulfonamide functional group attached to a benzoic acid structure. This compound typically exhibits properties such as moderate solubility in polar solvents due to its carboxylic acid and sulfonamide functionalities, while being less soluble in non-polar solvents. The presence of the fluorine atom can influence its reactivity and biological activity, potentially enhancing its pharmacological properties. As a sulfonamide, it may exhibit antibacterial activity, making it of interest in medicinal chemistry. The compound's molecular structure allows for hydrogen bonding, which can affect its interaction with biological targets. Additionally, it may undergo various chemical reactions typical of carboxylic acids and sulfonamides, such as esterification or nucleophilic substitution. Overall, 2-Fluoro-5-sulfamoyl-benzoic acid is a compound of interest in both synthetic and medicinal chemistry due to its unique functional groups and potential applications.
Formula:C7H6FNO4S
InChI:InChI=1/C7H6FNO4S/c8-6-2-1-4(14(9,12)13)3-5(6)7(10)11/h1-3H,(H,10,11)(H2,9,12,13)
InChI key:MNNOFRJMHLQDOE-UHFFFAOYSA-N
SMILES:c1cc(c(cc1S(=O)(=O)N)C(=O)O)F
Synonyms:
  • 2-Fluoro-5-sulfamoylbenzoic acid
Found 4 products.