CymitQuimica logo

CAS 112889-02-8

:

Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate

Description:
Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate, with the CAS number 112889-02-8, is a chemical compound that belongs to the class of amino acid derivatives. It features a diethyl ester functional group, which contributes to its solubility and reactivity. The presence of the 5-methylamino group indicates that it has an amino substituent, which can participate in various chemical reactions, including those involving nucleophilic attack. The thenoyl moiety, derived from thienoic acid, suggests that the compound may exhibit unique electronic properties and potential biological activity. This compound is likely to be polar due to the presence of both the amino and carboxyl functional groups, which can influence its interaction with biological systems. Additionally, its structure may allow for specific binding interactions with enzymes or receptors, making it of interest in pharmaceutical research. Overall, Diethyl N-[5-methylamino-2-thenoyl]-L-glutamate is characterized by its complex structure, potential biological relevance, and reactivity due to its functional groups.
Formula:C15H22N2O5S
InChI:InChI=1/C15H22N2O5S/c1-4-21-13(18)9-6-10(15(20)22-5-2)17-14(19)11-7-8-12(16-3)23-11/h7-8,10,16H,4-6,9H2,1-3H3,(H,17,19)/t10-/m0/s1
InChI key:OIUDYHGOODXYDK-JTQLQIEISA-N
SMILES:CCOC(=O)CC[C@@H](C(=O)OCC)NC(=O)c1ccc(NC)s1
Synonyms:
  • N-[[5-(Methylamino)-2-Thienyl]Carbonyl]-L-Glutamic Acid Diethyl Ester
  • diethyl N-{[5-(methylamino)thiophen-2-yl]carbonyl}-L-glutamate
  • Diethyl N-(5-methylamino-2-thenoyl)-L-glutamate
Found 5 products.