CAS 112894-47-0
:2,3-DIHYDRO-1-BENZOFURAN-5-SULFONAMIDE
Description:
2,3-Dihydro-1-benzofuran-5-sulfonamide is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and a sulfonamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The sulfonamide group is known for its ability to form hydrogen bonds, which can enhance solubility and reactivity in various chemical environments. The presence of the benzofuran structure may impart additional stability and influence the compound's interaction with biological targets. Generally, compounds like this can be investigated for their pharmacological properties, including antimicrobial or anti-inflammatory activities. The compound's solubility, melting point, and reactivity can vary based on its specific formulation and the presence of substituents. As with many sulfonamides, it may also exhibit specific interactions with enzymes or receptors, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H9NO3S
InChI:InChI=1/C8H9NO3S/c9-13(10,11)7-1-2-8-6(5-7)3-4-12-8/h1-2,5H,3-4H2,(H2,9,10,11)
SMILES:c1cc2c(CCO2)cc1S(=O)(=O)N
Synonyms:- 2,3-Dihydrobenzo[b]furan-5-sulphonamide
- 5-Benzofuransulfonamide,2,3-dihydro-(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,3-Dihydrobenzo[b]furan-5-sulphonamide
CAS:2,3-Dihydrobenzo[b]furan-5-sulphonamideFormula:C8H9NO3SPurity:≥95%Color and Shape:SolidMolecular weight:199.226962,3-Dihydro-1-benzofuran-5-sulfonamide
CAS:2,3-Dihydro-1-benzofuran-5-sulfonamide is a diuretic that has been shown to be effective in the treatment of hypertension. It is an alkyl ester with a carboxymethyl group and an alkoxycarbonyl group. This drug has been shown to be orally active, and can be administered as a pharmaceutical formulation. 2,3-Dihydro-1-benzofuran-5-sulfonamide binds to the sodium chloride channel in the kidney's distal tubule, which leads to increased water secretion by osmotic pressure. The diuretic effect is due to increased urination and decreased blood volume. 2,3-Dihydro-1-benzofuran-5-sulfonamide also blocks the enzyme cyclooxygenase (COX), which leads to reduced synthesis of prostaglandins.
Formula:C8H9NO3SPurity:Min. 95%Molecular weight:199.23 g/mol


