CymitQuimica logo

CAS 112898-23-4

:

N-T-boc-S-methyl-L-penicillamine*dicyclohexylammo

Description:
N-T-boc-S-methyl-L-penicillamine dicyclohexylammonium salt is a chemical compound that features a penicillamine backbone, which is an amino acid derivative known for its thiol group. The "N-T-boc" designation indicates that the amine group is protected by a tert-butyloxycarbonyl (Boc) group, which is commonly used in peptide synthesis to prevent unwanted reactions. The "S-methyl" part signifies the presence of a methyl group attached to the sulfur atom, enhancing its reactivity and solubility. The dicyclohexylammonium component suggests that the compound is a salt, which can influence its solubility and stability in various solvents. This compound is of interest in medicinal chemistry and biochemistry due to its potential applications in drug development and as a chelating agent. Its unique structure allows for specific interactions with biological targets, making it a valuable compound for research in therapeutic applications. As with many organosulfur compounds, it may exhibit interesting biological activities, including antioxidant properties.
Formula:C11H21NO4S·C12H23N
InChI:InChI=1S/C12H23N.C11H21NO4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-10(2,3)16-9(15)12-7(8(13)14)11(4,5)17-6/h11-13H,1-10H2;7H,1-6H3,(H,12,15)(H,13,14)/t;7-/m.1/s1
InChI key:FJACYLCGMGYDOE-HMZWWLAASA-N
SMILES:CC(C)(C)OC(=O)N[C@H](C(=O)O)C(C)(C)SC.C1CCC(CC1)NC2CCCCC2
Found 4 products.