CymitQuimica logo

CAS 1129-06-2

:

3-Cyclopropylbenzoic acid

Description:
3-Cyclopropylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a cyclopropyl group attached to the benzene ring at the meta position relative to the carboxylic acid functional group. This compound features a bicyclic structure that contributes to its unique chemical properties. It is typically a white to off-white solid at room temperature and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and acetone. The cyclopropyl group can influence the compound's reactivity and stability, often making it more reactive than its non-cyclopropyl counterparts. 3-Cyclopropylbenzoic acid can participate in various chemical reactions, including esterification and acylation, and is of interest in medicinal chemistry for its potential biological activities. Its molecular structure allows for interactions with biological targets, making it a subject of study in drug development. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c11-10(12)9-3-1-2-8(6-9)7-4-5-7/h1-3,6-7H,4-5H2,(H,11,12)
InChI key:RQRAQQYDNSRVRK-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)C(=O)O)C1CC1
Synonyms:
  • Benzoic acid, 3-cyclopropyl-
  • 3-Cyclopropylbenzoic acid
Found 4 products.