CymitQuimica logo

CAS 112935-93-0

:

5-(1-hydroxyethyl)-1,3-phenylene bis(dimethylcarbamate)

Description:
5-(1-Hydroxyethyl)-1,3-phenylene bis(dimethylcarbamate) is a chemical compound characterized by its structure, which includes a phenylene group substituted with two dimethylcarbamate moieties and a hydroxyethyl group. This compound is typically used in various applications, including as a potential intermediate in organic synthesis and in the development of agrochemicals. Its molecular structure suggests it may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbamate functional groups. The hydroxyethyl substituent may impart additional hydrophilicity, influencing its behavior in biological systems or during chemical reactions. Safety data and handling precautions should be considered, as compounds with carbamate functionalities can exhibit toxicity and environmental persistence. Overall, this compound's unique structural features contribute to its utility in chemical research and industrial applications.
Formula:C14H20N2O5
InChI:InChI=1S/C14H20N2O5/c1-9(17)10-6-11(20-13(18)15(2)3)8-12(7-10)21-14(19)16(4)5/h6-9,17H,1-5H3
InChI key:GSPOTIPIYTUHQP-UHFFFAOYSA-N
SMILES:CC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O
Found 4 products.