CymitQuimica logo

CAS 112940-51-9

:

Piperazine, 1-(3-methyl-4-pyridinyl)- (9CI)

Description:
Piperazine, 1-(3-methyl-4-pyridinyl)-, also known by its CAS number 112940-51-9, is a chemical compound that belongs to the piperazine class of compounds, which are characterized by a six-membered ring containing two nitrogen atoms. This specific derivative features a pyridine ring substituted with a methyl group at the 3-position, contributing to its unique properties. The compound is typically a solid at room temperature and is soluble in polar solvents, which is common for many piperazine derivatives. It exhibits basic properties due to the presence of the piperazine moiety, allowing it to interact with various biological targets. Piperazine derivatives are often studied for their pharmacological potential, including applications in medicinal chemistry, where they may exhibit activity against certain diseases or conditions. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific structural variation within the broader category of piperazine-based chemicals, with implications for research and application in various fields.
Formula:C10H15N3
InChI:InChI=1/C10H15N3/c1-9-8-12-3-2-10(9)13-6-4-11-5-7-13/h2-3,8,11H,4-7H2,1H3
InChI key:QIELQJJSSZTEJW-UHFFFAOYSA-N
SMILES:Cc1cnccc1N1CCNCC1
Synonyms:
  • 1-(3-Methylpyridin-4-Yl)Piperazine
Found 2 products.