CymitQuimica logo

CAS 112960-56-2

:

(3-METHYL-1,2,4-OXADIAZOL-5-YL)METHANOL

Description:
(3-Methyl-1,2,4-oxadiazol-5-yl)methanol is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a hydroxymethyl group (-CH2OH) attached to the oxadiazole ring contributes to its potential as a versatile building block in organic synthesis. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests polar characteristics due to the hydroxymethyl group, which can influence its solubility and reactivity in different solvents. Additionally, the methyl group at the 3-position of the oxadiazole ring can affect the compound's electronic properties and steric hindrance. As with many heterocycles, (3-methyl-1,2,4-oxadiazol-5-yl)methanol may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a valuable compound in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C4H6N2O2
InChI:InChI=1/C4H6N2O2/c1-3-5-4(2-7)8-6-3/h7H,2H2,1H3
InChI key:OQKJMIGPYYWVKU-UHFFFAOYSA-N
SMILES:Cc1nc(CO)on1
Found 4 products.