CAS 112966-16-2
:Spiro[3H-3a,6-ethanoisobenzofuran-4(1H),1'(3'H)-isobenzofuran]-1,3'-dione,3-butylidene-5,6,6',7'-tetrahydro-5-propyl-, (1'S,3Z,3aS,5R,6R)-
Description:
Spiro[3H-3a,6-ethanoisobenzofuran-4(1H),1'(3'H)-isobenzofuran]-1,3'-dione, with the CAS number 112966-16-2, is a complex organic compound characterized by its unique spirocyclic structure, which features a fused bicyclic system. This compound contains multiple functional groups, including diones and isobenzofurans, contributing to its potential reactivity and biological activity. The stereochemistry indicated by its IUPAC name suggests specific spatial arrangements of atoms, which can influence its interactions in chemical reactions and biological systems. The presence of butylidene and propyl substituents suggests that it may exhibit hydrophobic characteristics, potentially affecting its solubility and permeability in biological membranes. Such compounds are often studied for their potential pharmacological properties, including anti-inflammatory or anticancer activities. However, detailed studies on its specific properties, such as melting point, boiling point, solubility, and biological activity, would be necessary to fully understand its applications and behavior in various environments.
Formula:C24H28O4
InChI:InChI=1S/C24H28O4/c1-3-5-11-20-23-13-12-15(14-19(23)22(26)27-20)17(8-4-2)24(23)18-10-7-6-9-16(18)21(25)28-24/h6,9,11,14-15,17H,3-5,7-8,10,12-13H2,1-2H3/b20-11-/t15-,17-,23?,24+/m1/s1
InChI key:InChIKey=DZMFTLLDUYBHLI-SWCBZASASA-N
SMILES:C(CC)[C@H]1[C@@]2([C@]3\4C(=C[C@]1(CC3)[H])C(=O)O/C4=C\CCC)C5=C(C(=O)O2)C=CCC5
Synonyms:- (1′S,3Z,3aS,5R,6R)-3-Butylidene-5,6,6′,7′-tetrahydro-5-propylspiro[3H-3a,6-ethanoisobenzofuran-4(1H),1′(3′H)-isobenzofuran]-1,3′-dione
- (3'Z)-(3S,8R,3a'S,6'R)-3,3a':8,6'-Diligustilide
- (3′Z)-(3S,8R,3a'S,6′R)-3,3a′:8,6′-Diligustilide
- Spiro[3H-3a,6-ethanoisobenzofuran-4(1H),1'(3'H)-isobenzofuran]-1,3'-dione,3-butylidene-5,6,6',7'-tetrahydro-5-propyl-, [3aS-(3Z,3aa,4a,5a,6a)]-
- Spiro[3H-3a,6-ethanoisobenzofuran-4(1H),1′(3′H)-isobenzofuran]-1,3′-dione, 3-butylidene-5,6,6′,7′-tetrahydro-5-propyl-, (1′S,3Z,3aS,5R,6R)-
- Spiro[3H-3a,6-ethanoisobenzofuran-4(1H),1′(3′H)-isobenzofuran]-1,3′-dione, 3-butylidene-5,6,6′,7′-tetrahydro-5-propyl-, [3aS-(3Z,3aα,4α,5α,6α)]-
- Tokinolide B
- 6'R)-3
- Spiro[3H-3a,6-ethanoisobenzofuran-4(1H),1'(3'H)-isobenzofuran]-1,3'-dione,3-butylidene-5,6,6',7'-tetrahydro-5-propyl-, (1'S,3Z,3aS,5R,6R)-
- (3'Z)-(3S
- 3A':8
- See more synonyms
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Tokinolide B
CAS:Tokinolide B is a high-purity biochemical reagent widely used in biochemical experiments and drug synthesis research.Formula:C24H28O4Purity:98.64%Color and Shape:SolidMolecular weight:380.48Tokinolide B
CAS:Tokinolide B is a secondary metabolite, which is a naturally occurring compound derived from marine cyanobacteria. These microorganisms are prolific producers of a diverse array of bioactive metabolites, often possessing unique structural properties that inspire scientific investigation. Tokinolide B has been identified for its intriguing mode of action, primarily its anti-inflammatory effects, which are thought to be mediated through the modulation of specific cellular signaling pathways involved in inflammation.
Formula:C24H28O4Purity:Min. 95%Molecular weight:380.48 g/mol






