CymitQuimica logo

CAS 112970-44-2

:

2-Bromo-3-Aminoanisole

Description:
2-Bromo-3-aminoanisole, with the CAS number 112970-44-2, is an organic compound characterized by the presence of a bromine atom and an amino group attached to a methoxy-substituted aromatic ring. This compound features a bromine atom at the second position and an amino group at the third position of the anisole structure, which is a benzene ring with a methoxy (-OCH₃) group. It typically appears as a solid or crystalline substance and is soluble in organic solvents. The presence of both the bromine and amino functional groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it useful in organic synthesis and pharmaceutical applications. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 2-bromo-3-aminoanisole is a versatile compound with potential applications in various fields of chemistry.
Formula:C7H8BrNO
InChI:InChI=1/C7H8BrNO/c1-10-6-4-2-3-5(9)7(6)8/h2-4H,9H2,1H3
InChI key:TUNIZJPEKHLBPR-UHFFFAOYSA-N
SMILES:COc1cccc(c1Br)N
Synonyms:
  • 2-Bromo-3-methoxyaniline
  • 2-Bromo-3-Methoxybenzenamine
Found 4 products.